CAS 641144-16-3 appears in our catalog under these names: 10–Bromoanthracene–9–boronic acid, 10-BROMOANTHRACENE-9-BORONIC ACID, (10-Bromoanthracen-9-yl)boronic acid, 95%, 95%, 10-BROMOANTHRACENE-9-BORONIC ACID, 95%. Offered by: GLPBio, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 1g, 10G, 5g, 25g, 250mg.
(10-bromoanthracen-9-yl)boronic acid (CAS 641144-16-3) is a chemical compound with the molecular formula C14H10BBrO2 and a molecular weight of 300.94 g/mol. IUPAC name: (10-bromoanthracen-9-yl)boronic acid. InChIKey: FAVOIVPFJSKYBE-UHFFFAOYSA-N.
| Molecular formula | C14H10BBrO2 |
|---|---|
| Molecular weight | 300.94 g/mol |
| IUPAC name | (10-bromoanthracen-9-yl)boronic acid |
| InChIKey | FAVOIVPFJSKYBE-UHFFFAOYSA-N |
| SMILES | B(C1=C2C=CC=CC2=C(C3=CC=CC=C13)Br)(O)O |
Computed by PubChem (NCBI)