cas: 57452-98-9 — see every product listed under this CAS number, including other names
(11bR)-2-(Cyclohexylcarbonyl)-1,2,3,6,7,11b-hexahydro-4H-pyrazino[2,1-a]isoquinolin-4-one, 99%, 99% (CAS 57452-98-9) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11EGWG-50mg |
| cas | 57452-98-9 |
| size | 50mg |
| availability | 0.44g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 472.40 Pln | |
| Chemat | 100mg | 534.80 Pln | |
| Chemat | 250mg | 962.00 Pln |
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
(11bR)-2-(cyclohexanecarbonyl)-3,6,7,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-4-one (CAS 57452-98-9) is a chemical compound with the molecular formula C19H24N2O2 and a molecular weight of 312.4 g/mol. IUPAC name: (11bR)-2-(cyclohexanecarbonyl)-3,6,7,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-4-one. InChIKey: FSVJFNAIGNNGKK-KRWDZBQOSA-N.
| Molecular formula | C19H24N2O2 |
|---|---|
| Molecular weight | 312.4 g/mol |
| IUPAC name | (11bR)-2-(cyclohexanecarbonyl)-3,6,7,11b-tetrahydro-1H-pyrazino[2,1-a]isoquinolin-4-one |
| InChIKey | FSVJFNAIGNNGKK-KRWDZBQOSA-N |
| SMILES | C1CCC(CC1)C(=O)N2C[C@H]3C4=CC=CC=C4CCN3C(=O)C2 |
Computed by PubChem (NCBI)