(16aS)-1,16-Bis(diphenylphosphino)-6,7,8,9,10,11-hexahydrodibenzo[b,d][1,6]dioxacyclododecine, 98%
cas: 486429-96-3 — see every product listed under this CAS number, including other names
(16aS)-1,16-Bis(diphenylphosphino)-6,7,8,9,10,11-hexahydrodibenzo[b,d][1,6]dioxacyclododecine, 98% (CAS 486429-96-3) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A403133-100mg |
| cas | 486429-96-3 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 709.69 Pln | |
| Ambeed | 250mg | 1449.50 Pln | |
| Ambeed | 1g | 4714.69 Pln | |
| Ambeed | 5g | 18654.31 Pln | |
| Chemat | 100mg | 669.20 Pln | |
| Chemat | 250mg | 1389.20 Pln | |
| Chemat | 1g | 4518.80 Pln | |
| Chemat | 5g | 17882.00 Pln | |
| BLDpharm | 100mg | 697.56 Pln | |
| BLDpharm | 250mg | 1419.52 Pln | |
| BLDpharm | 1g | 4623.95 Pln | |
| BLDpharm | 5g | 18280.25 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
(20-diphenylphosphanyl-8,15-dioxatricyclo[14.4.0.02,7]icosa-1(16),2(7),3,5,17,19-hexaen-3-yl)-diphenylphosphane (CAS 486429-96-3) is a chemical compound with the molecular formula C42H38O2P2 and a molecular weight of 636.7 g/mol. IUPAC name: (20-diphenylphosphanyl-8,15-dioxatricyclo[14.4.0.02,7]icosa-1(16),2(7),3,5,17,19-hexaen-3-yl)-diphenylphosphane. InChIKey: UENGBNLSVKNPJN-UHFFFAOYSA-N.
| Molecular formula | C42H38O2P2 |
|---|---|
| Molecular weight | 636.7 g/mol |
| IUPAC name | (20-diphenylphosphanyl-8,15-dioxatricyclo[14.4.0.02,7]icosa-1(16),2(7),3,5,17,19-hexaen-3-yl)-diphenylphosphane |
| InChIKey | UENGBNLSVKNPJN-UHFFFAOYSA-N |
| SMILES | C1CCCOC2=C(C(=CC=C2)P(C3=CC=CC=C3)C4=CC=CC=C4)C5=C(C=CC=C5P(C6=CC=CC=C6)C7=CC=CC=C7)OCC1 |
Computed by PubChem (NCBI)
Synonyms:
(S)-C6-Tunephos