cas: 1400279-62-0 — see every product listed under this CAS number, including other names
(1E,4E)-1-(4-Bromophenyl)-5-phenylpenta-1,4-dien-3-one, 95-<97% (CAS 1400279-62-0) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 25g. Offered by: Hoffman Fine Chemicals.
| brand | Hoffman Fine Chemicals |
|---|---|
| catalog number | HFC6989-95-97-5g |
| cas | 1400279-62-0 |
| size | 5g |
| availability | 3-4 tygodnie|3-4 weeks |
| brand | size | price | |
|---|---|---|---|
| Hoffman Fine Chemicals | 5g | 8582.86 Pln | |
| Hoffman Fine Chemicals | 10g | 13546.50 Pln | |
| Hoffman Fine Chemicals | 25g | 26785.00 Pln |
| purity | 95-<97% |
|---|---|
| category | Chemicals |
| delivery time | 3-4 weeks |
(1E,4E)-1-(4-bromophenyl)-5-phenylpenta-1,4-dien-3-one (CAS 1400279-62-0) is a chemical compound with the molecular formula C17H13BrO and a molecular weight of 313.2 g/mol. IUPAC name: (1E,4E)-1-(4-bromophenyl)-5-phenylpenta-1,4-dien-3-one. InChIKey: ISJWUXJITQKKSL-QHKWOANTSA-N.
| Molecular formula | C17H13BrO |
|---|---|
| Molecular weight | 313.2 g/mol |
| IUPAC name | (1E,4E)-1-(4-bromophenyl)-5-phenylpenta-1,4-dien-3-one |
| InChIKey | ISJWUXJITQKKSL-QHKWOANTSA-N |
| SMILES | C1=CC=C(C=C1)/C=C/C(=O)/C=C/C2=CC=C(C=C2)Br |
Computed by PubChem (NCBI)