cas: 53402-10-1 — see every product listed under this CAS number, including other names
(1R)-(-)-Thiocamphor, >97.0%(GC) (CAS 53402-10-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | T1863-1G |
| cas | 53402-10-1 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 339.62 Pln | |
| TCI | 5g | 1121.46 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(GC) |
(1R,4R)-1,7,7-trimethylbicyclo[2.2.1]heptane-2-thione (CAS 53402-10-1) is a chemical compound with the molecular formula C10H16S and a molecular weight of 168.30 g/mol. IUPAC name: (1R,4R)-1,7,7-trimethylbicyclo[2.2.1]heptane-2-thione. InChIKey: AAADKYXUTOBAGS-XCBNKYQSSA-N.
| Molecular formula | C10H16S |
|---|---|
| Molecular weight | 168.30 g/mol |
| IUPAC name | (1R,4R)-1,7,7-trimethylbicyclo[2.2.1]heptane-2-thione |
| InChIKey | AAADKYXUTOBAGS-XCBNKYQSSA-N |
| SMILES | C[C@@]12CC[C@@H](C1(C)C)CC2=S |
Computed by PubChem (NCBI)