(1R)-2,2'-Bis((S)-4-phenyl-4,5-dihydrooxazol-2-yl)-1,1'-binaphthalene, 97%
cas: 958238-94-3 — see every product listed under this CAS number, including other names
(1R)-2,2'-Bis((S)-4-phenyl-4,5-dihydrooxazol-2-yl)-1,1'-binaphthalene, 97% (CAS 958238-94-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 100mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A1519823-250mg |
| cas | 958238-94-3 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1316.00 Pln | |
| Ambeed | 1g | 3335.19 Pln | |
| Ambeed | 5g | 13141.88 Pln | |
| Chemat | 100mg | 558.80 Pln | |
| Chemat | 250mg | 899.60 Pln | |
| Chemat | 1g | 2325.20 Pln | |
| BLDpharm | 100mg | 775.31 Pln | |
| BLDpharm | 250mg | 1286.24 Pln | |
| BLDpharm | 1g | 3274.43 Pln | |
| BLDpharm | 5g | 12887.71 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
(4S)-4-phenyl-2-[1-[2-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]naphthalen-1-yl]naphthalen-2-yl]-4,5-dihydro-1,3-oxazole (CAS 958238-94-3) is a chemical compound with the molecular formula C38H28N2O2 and a molecular weight of 544.6 g/mol. IUPAC name: (4S)-4-phenyl-2-[1-[2-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]naphthalen-1-yl]naphthalen-2-yl]-4,5-dihydro-1,3-oxazole. InChIKey: QAEMDACRMMNKPF-KKLWWLSJSA-N.
| Molecular formula | C38H28N2O2 |
|---|---|
| Molecular weight | 544.6 g/mol |
| IUPAC name | (4S)-4-phenyl-2-[1-[2-[(4S)-4-phenyl-4,5-dihydro-1,3-oxazol-2-yl]naphthalen-1-yl]naphthalen-2-yl]-4,5-dihydro-1,3-oxazole |
| InChIKey | QAEMDACRMMNKPF-KKLWWLSJSA-N |
| SMILES | C1[C@@H](N=C(O1)C2=C(C3=CC=CC=C3C=C2)C4=C(C=CC5=CC=CC=C54)C6=N[C@H](CO6)C7=CC=CC=C7)C8=CC=CC=C8 |
Computed by PubChem (NCBI)
Synonyms:
(1R)-2,2'-Bis((S)-4-phenyl-4,5-dihydrooxazol-2-yl)-1,1'-binaphthalene, (1S)-2,2'-Bis((S)-4-phenyl-4,5-dihydrooxazol-2-yl)-1,1'-binaphthalene, (1R)-2,2'-Bis((R)-4-phenyl-4,5-dihydrooxazol-2-yl)-1,1'-binaphthalene, 2,2'-bis((S)-4-phenyl-4,5-dihydrooxazol-2-yl)-1,1'-binaphthalene, (S)-2,2'-bis((S)-4-phenyl-4,5-dihydrooxazol-2-yl)-1,1'-binaphthalene, (1S)-22'-Bis((S)-4-phenyl-45-dihydrooxazol-2-yl)-11'-binaphthalene, (4S,4'S)-2,2'-(1S)-[1,1'-Binaphthalene]-2,2'-diylbis[4,5-dihydro-4-phenyloxazole