cas: 885677-92-9 — see every product listed under this CAS number, including other names
(1R,2R)-2-(Pyrrolidin-1-yl)cyclohexanamine 97% (CAS 885677-92-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A816040-100mg |
| cas | 885677-92-9 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 370.38 Pln | |
| Ambeed | 250mg | 565.06 Pln | |
| Ambeed | 1g | 2055.81 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A816040 |
Trans-(1R,2R)-2-pyrrolidin-1-ylcyclohexan-1-amine (CAS 885677-92-9) is a chemical compound with the molecular formula C10H20N2 and a molecular weight of 168.28 g/mol. IUPAC name: trans-(1R,2R)-2-pyrrolidin-1-ylcyclohexan-1-amine. InChIKey: FLEFKPPJPOWCSZ-NXEZZACHSA-N.
| Molecular formula | C10H20N2 |
|---|---|
| Molecular weight | 168.28 g/mol |
| IUPAC name | trans-(1R,2R)-2-pyrrolidin-1-ylcyclohexan-1-amine |
| InChIKey | FLEFKPPJPOWCSZ-NXEZZACHSA-N |
| SMILES | C1CC[C@H]([C@@H](C1)N)N2CCCC2 |
Computed by PubChem (NCBI)