cas: 644958-86-1 — see every product listed under this CAS number, including other names
(1R,2R)-N,N'-Dimethyl-N,N'-bis(3,3-dimethylbutyl)cyclohexane-1,2-diamine, >97.0%(GC) (CAS 644958-86-1) is a chemical reagent available from Chemat. Available pack sizes: 1g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | D3808-1G |
| cas | 644958-86-1 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 1028.04 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >97.0%(GC) |
Trans-(1R,2R)-1-N,2-N-bis(3,3-dimethylbutyl)-1-N,2-N-dimethylcyclohexane-1,2-diamine (CAS 644958-86-1) is a chemical compound with the molecular formula C20H42N2 and a molecular weight of 310.6 g/mol. IUPAC name: trans-(1R,2R)-1-N,2-N-bis(3,3-dimethylbutyl)-1-N,2-N-dimethylcyclohexane-1,2-diamine. InChIKey: VGCWVKVNKNXOGZ-QZTJIDSGSA-N.
| Molecular formula | C20H42N2 |
|---|---|
| Molecular weight | 310.6 g/mol |
| IUPAC name | trans-(1R,2R)-1-N,2-N-bis(3,3-dimethylbutyl)-1-N,2-N-dimethylcyclohexane-1,2-diamine |
| InChIKey | VGCWVKVNKNXOGZ-QZTJIDSGSA-N |
| SMILES | CC(C)(C)CCN(C)[C@@H]1CCCC[C@H]1N(C)CCC(C)(C)C |
Computed by PubChem (NCBI)