(1R,2R)-N1,N2-Bis(2-(bis(3,5-dimethylphenyl)phosphino)benzyl)cyclohexane-1,2-diamine, 98% 99%ee
cas: 1150113-66-8 — see every product listed under this CAS number, including other names
(1R,2R)-N1,N2-Bis(2-(bis(3,5-dimethylphenyl)phosphino)benzyl)cyclohexane-1,2-diamine, 98% 99%ee (CAS 1150113-66-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A471203-100mg |
| cas | 1150113-66-8 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 509.44 Pln | |
| Ambeed | 1g | 1199.19 Pln | |
| Ambeed | 5g | 4581.19 Pln | |
| Chemat | 100mg | 342.80 Pln | |
| Chemat | 250mg | 539.60 Pln | |
| Chemat | 1g | 1350.80 Pln | |
| BLDpharm | 100mg | 347.68 Pln | |
| BLDpharm | 250mg | 542.06 Pln | |
| BLDpharm | 1g | 1286.24 Pln | |
| BLDpharm | 5g | 4934.95 Pln |
properties
| purity | 98% 99%ee |
|---|---|
| delivery time | 1-2 weeks |
Trans-(1R,2R)-2-N,2-N-bis[[2-bis(3,5-dimethylphenyl)phosphanylphenyl]methyl]cyclohexane-1,2-diamine (CAS 1150113-66-8) is a chemical compound with the molecular formula C52H60N2P2 and a molecular weight of 775.0 g/mol. IUPAC name: trans-(1R,2R)-2-N,2-N-bis[[2-bis(3,5-dimethylphenyl)phosphanylphenyl]methyl]cyclohexane-1,2-diamine. InChIKey: JGZZEPZYYHSWHV-CDKYPKJRSA-N.
| Molecular formula | C52H60N2P2 |
|---|---|
| Molecular weight | 775.0 g/mol |
| IUPAC name | trans-(1R,2R)-2-N,2-N-bis[[2-bis(3,5-dimethylphenyl)phosphanylphenyl]methyl]cyclohexane-1,2-diamine |
| InChIKey | JGZZEPZYYHSWHV-CDKYPKJRSA-N |
| SMILES | CC1=CC(=CC(=C1)P(C2=CC=CC=C2CN(CC3=CC=CC=C3P(C4=CC(=CC(=C4)C)C)C5=CC(=CC(=C5)C)C)[C@@H]6CCCC[C@H]6N)C7=CC(=CC(=C7)C)C)C |
Computed by PubChem (NCBI)