CAS 22422-34-0 appears in our catalog under these names: (-)-Pinanediol, (1R,2R,3S,5R)-(-)-2,3-Pinanediol, (1R,2R,3S,5R)–(–)–2,3–Pinanediol, (1R,2R,3S,5R)-(-)-2,3-Pinanediol, >98.0%(GC), (1R,2R,3S,5R)-(-)-PINANEDIOL, 99%. Offered by: Chemat Brand, TRC, GLPBio, TCI, Sigma-Aldrich. Available pack sizes: on request, 1g, 50g, 5g, 100g, 25g, 250mg, 10g.
(1R,2R,3S,5R)-2,6,6-trimethylbicyclo[3.1.1]heptane-2,3-diol (CAS 22422-34-0) is a chemical compound with the molecular formula C10H18O2 and a molecular weight of 170.25 g/mol. IUPAC name: (1R,2R,3S,5R)-2,6,6-trimethylbicyclo[3.1.1]heptane-2,3-diol. InChIKey: MOILFCKRQFQVFS-BDNRQGISSA-N.
| Molecular formula | C10H18O2 |
|---|---|
| Molecular weight | 170.25 g/mol |
| IUPAC name | (1R,2R,3S,5R)-2,6,6-trimethylbicyclo[3.1.1]heptane-2,3-diol |
| InChIKey | MOILFCKRQFQVFS-BDNRQGISSA-N |
| SMILES | C[C@]1([C@@H]2C[C@@H](C2(C)C)C[C@@H]1O)O |
Computed by PubChem (NCBI)