cas: 127641-25-2 — see every product listed under this CAS number, including other names
(1R,2S)-1-PHENYL-2-PYRROLIDIN-1-YL-PROPAN-1-OL, 98% (CAS 127641-25-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F303389-1G |
| cas | 127641-25-2 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 1g | 581.06 Pln | |
| Fluorochem | 5g | 935.11 Pln | |
| Fluorochem | 25g | 2252.35 Pln |
| purity | 98% |
|---|---|
| delivery time | 3-4 weeks |
(1R,2S)-1-phenyl-2-pyrrolidin-1-ylpropan-1-ol (CAS 127641-25-2) is a chemical compound with the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. IUPAC name: (1R,2S)-1-phenyl-2-pyrrolidin-1-ylpropan-1-ol. InChIKey: FZVHJGJBJLFWEX-AAEUAGOBSA-N.
| Molecular formula | C13H19NO |
|---|---|
| Molecular weight | 205.30 g/mol |
| IUPAC name | (1R,2S)-1-phenyl-2-pyrrolidin-1-ylpropan-1-ol |
| InChIKey | FZVHJGJBJLFWEX-AAEUAGOBSA-N |
| SMILES | C[C@@H]([C@@H](C1=CC=CC=C1)O)N2CCCC2 |
Computed by PubChem (NCBI)