(1R,2S)-2-(3,4-Difluorophenyl)cyclopropanamine (2R,3R)-2,3-Dihydroxysuccinate, 96%
cas: 220352-39-6 — see every product listed under this CAS number, including other names
(1R,2S)-2-(3,4-Difluorophenyl)cyclopropanamine (2R,3R)-2,3-Dihydroxysuccinate, 96% (CAS 220352-39-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A106695-100mg |
| cas | 220352-39-6 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 125.62 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 170.12 Pln | |
| Ambeed | 5g | 364.81 Pln | |
| Ambeed | 10g | 548.38 Pln | |
| Chemat | 250mg | 102.80 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 395.60 Pln | |
| BLDpharm | 250mg | 131.09 Pln | |
| BLDpharm | 1g | 158.86 Pln | |
| BLDpharm | 5g | 392.11 Pln | |
| BLDpharm | 10g | 580.93 Pln |
properties
| purity | 96% |
|---|---|
| delivery time | 1-2 weeks |
(2R,3R)-2,3-dihydroxybutanedioic acid;trans-(1R,2S)-2-(3,4-difluorophenyl)cyclopropan-1-amine (CAS 220352-39-6) is a chemical compound with the molecular formula C13H15F2NO6 and a molecular weight of 319.26 g/mol. IUPAC name: (2R,3R)-2,3-dihydroxybutanedioic acid;trans-(1R,2S)-2-(3,4-difluorophenyl)cyclopropan-1-amine. InChIKey: FXPRRXBPZROCLZ-ABXGAMCJSA-N.
| Molecular formula | C13H15F2NO6 |
|---|---|
| Molecular weight | 319.26 g/mol |
| IUPAC name | (2R,3R)-2,3-dihydroxybutanedioic acid;trans-(1R,2S)-2-(3,4-difluorophenyl)cyclopropan-1-amine |
| InChIKey | FXPRRXBPZROCLZ-ABXGAMCJSA-N |
| SMILES | C1[C@H]([C@@H]1N)C2=CC(=C(C=C2)F)F.[C@@H]([C@H](C(=O)O)O)(C(=O)O)O |
Computed by PubChem (NCBI)
Synonyms:
(1R,2S)-2-(3,4-Difluorophenyl)cyclopropanamine (2R,3R)-2,3-Dihydroxysuccinate, Ticagrelor Impurity X, (1R,2S)-2-(3,4-difluorophenyl)cyclopropan-1-amine (2R,3R)-2,3-dihydroxysuccinate, (1R,2S)-2-(3,4-Difluorophenyl)cyclopropanamine-(2R,3R)-2,3-dihydroxysuccinate, Ticagrelor Impurity 251, (1R,2S)-2-(3,4-Difluorophenyl)cyclopropanamine(2R,3R)-2,3-Dihydroxysuccinate, (1R,2S)-2-(3,4-difluorophenyl)cyclopropanamine L-Tartaric acid, Cyclopropanamine,2-(3,4-difluorophenyl)-(1R,2S)-(2R,3R)-2,3-..., Cyclopropanamine,2-(3,4-difluorophenyl)-(1R,2S) -(2R,3R)-2,3-dihydroxybuta