cas: 322407-34-1 — see every product listed under this CAS number, including other names
(1S,2S)-2-(Benzylamino)cyclohexanol, 97%, 97% (CAS 322407-34-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BIZ-1g |
| cas | 322407-34-1 |
| size | 1g |
| availability | 14g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 98.00 Pln | |
| Chemat | 5g | 165.20 Pln | |
| Chemat | 10g | 261.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Trans-(1S,2S)-2-(benzylamino)cyclohexan-1-ol (CAS 322407-34-1) is a chemical compound with the molecular formula C13H19NO and a molecular weight of 205.30 g/mol. IUPAC name: trans-(1S,2S)-2-(benzylamino)cyclohexan-1-ol. InChIKey: NJNCYFUGUYIMEQ-STQMWFEESA-N.
| Molecular formula | C13H19NO |
|---|---|
| Molecular weight | 205.30 g/mol |
| IUPAC name | trans-(1S,2S)-2-(benzylamino)cyclohexan-1-ol |
| InChIKey | NJNCYFUGUYIMEQ-STQMWFEESA-N |
| SMILES | C1CC[C@@H]([C@H](C1)NCC2=CC=CC=C2)O |
Computed by PubChem (NCBI)