cas: 767291-67-8 — see every product listed under this CAS number, including other names
(1S,2S)-N1,N2-Bis(3,3-dimethylbutyl)-N1,N2-dimethylcyclohexane-1,2-diamine, 97%, 97% (CAS 767291-67-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114BJ0-250mg |
| cas | 767291-67-8 |
| size | 250mg |
| availability | 30g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 203.60 Pln | |
| Chemat | 5g | 640.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Trans-(1S,2S)-1-N,2-N-bis(3,3-dimethylbutyl)-1-N,2-N-dimethylcyclohexane-1,2-diamine (CAS 767291-67-8) is a chemical compound with the molecular formula C20H42N2 and a molecular weight of 310.6 g/mol. IUPAC name: trans-(1S,2S)-1-N,2-N-bis(3,3-dimethylbutyl)-1-N,2-N-dimethylcyclohexane-1,2-diamine. InChIKey: VGCWVKVNKNXOGZ-ROUUACIJSA-N.
| Molecular formula | C20H42N2 |
|---|---|
| Molecular weight | 310.6 g/mol |
| IUPAC name | trans-(1S,2S)-1-N,2-N-bis(3,3-dimethylbutyl)-1-N,2-N-dimethylcyclohexane-1,2-diamine |
| InChIKey | VGCWVKVNKNXOGZ-ROUUACIJSA-N |
| SMILES | CC(C)(C)CCN(C)[C@H]1CCCC[C@@H]1N(C)CCC(C)(C)C |
Computed by PubChem (NCBI)