cas: 1031335-25-7 — see every product listed under this CAS number, including other names
(1S,3R)-3-Amino-1-(Boc-amino)cyclopentane, 98% (CAS 1031335-25-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A960930-100mg |
| cas | 1031335-25-7 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 414.88 Pln | |
| Ambeed | 250mg | 654.06 Pln | |
| Ambeed | 1g | 865.44 Pln | |
| Ambeed | 5g | 3134.94 Pln | |
| Ambeed | 10g | 4831.50 Pln | |
| Ambeed | 25g | 11706.75 Pln | |
| BLDpharm | 100mg | 442.09 Pln | |
| BLDpharm | 250mg | 697.56 Pln | |
| BLDpharm | 1g | 925.25 Pln | |
| BLDpharm | 5g | 3374.39 Pln | |
| BLDpharm | 10g | 5207.08 Pln | |
| BLDpharm | 25g | 12615.58 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Tert-butyl N-[(1S,3R)-3-aminocyclopentyl]carbamate (CAS 1031335-25-7) is a chemical compound with the molecular formula C10H20N2O2 and a molecular weight of 200.28 g/mol. IUPAC name: tert-butyl N-[(1S,3R)-3-aminocyclopentyl]carbamate. InChIKey: PGBVMVTUWHCOHX-SFYZADRCSA-N.
| Molecular formula | C10H20N2O2 |
|---|---|
| Molecular weight | 200.28 g/mol |
| IUPAC name | tert-butyl N-[(1S,3R)-3-aminocyclopentyl]carbamate |
| InChIKey | PGBVMVTUWHCOHX-SFYZADRCSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[C@H](C1)N |
Computed by PubChem (NCBI)