cas: 380430-67-1 — see every product listed under this CAS number, including other names
(2,3,6-Trimethoxyphenyl)boronic acid, 95% (CAS 380430-67-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F338079-250MG |
| cas | 380430-67-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 331.15 Pln | |
| Fluorochem | 1g | 601.89 Pln | |
| Fluorochem | 5g | 2122.19 Pln | |
| Fluorochem | 10g | 3762.23 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
(2,3,6-trimethoxyphenyl)boronic acid (CAS 380430-67-1) is a chemical compound with the molecular formula C9H13BO5 and a molecular weight of 212.01 g/mol. IUPAC name: (2,3,6-trimethoxyphenyl)boronic acid. InChIKey: PBJYOPCURLYSAG-UHFFFAOYSA-N.
| Molecular formula | C9H13BO5 |
|---|---|
| Molecular weight | 212.01 g/mol |
| IUPAC name | (2,3,6-trimethoxyphenyl)boronic acid |
| InChIKey | PBJYOPCURLYSAG-UHFFFAOYSA-N |
| SMILES | B(C1=C(C=CC(=C1OC)OC)OC)(O)O |
Computed by PubChem (NCBI)