cas: 95753-26-7 — see every product listed under this CAS number, including other names
(2-((Diisopropylamino)methyl)phenyl)boronic acid, 97% (CAS 95753-26-7) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F211569-250MG |
| cas | 95753-26-7 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 1216.26 Pln | |
| Fluorochem | 1g | 2814.65 Pln | |
| Fluorochem | 5g | 9203.03 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
[2-[[di(propan-2-yl)amino]methyl]phenyl]boronic acid (CAS 95753-26-7) is a chemical compound with the molecular formula C13H22BNO2 and a molecular weight of 235.13 g/mol. IUPAC name: [2-[[di(propan-2-yl)amino]methyl]phenyl]boronic acid. InChIKey: OZJANVKXMUYIQC-UHFFFAOYSA-N.
| Molecular formula | C13H22BNO2 |
|---|---|
| Molecular weight | 235.13 g/mol |
| IUPAC name | [2-[[di(propan-2-yl)amino]methyl]phenyl]boronic acid |
| InChIKey | OZJANVKXMUYIQC-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1CN(C(C)C)C(C)C)(O)O |
Computed by PubChem (NCBI)