cas: 1373320-84-3 — see every product listed under this CAS number, including other names
(2-((o-Tolylamino)methyl)phenyl)boronic acid 95% (CAS 1373320-84-3) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1274599-25mg |
| cas | 1373320-84-3 |
| size | 25mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 25mg | 281.38 Pln | |
| Ambeed | 50mg | 420.44 Pln | |
| Ambeed | 100mg | 659.62 Pln | |
| Ambeed | 250mg | 1126.88 Pln | |
| Ambeed | 1g | 2300.56 Pln |
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1274599 |
[2-[(2-methylanilino)methyl]phenyl]boronic acid (CAS 1373320-84-3) is a chemical compound with the molecular formula C14H16BNO2 and a molecular weight of 241.10 g/mol. IUPAC name: [2-[(2-methylanilino)methyl]phenyl]boronic acid. InChIKey: WLVOCMANYICPSJ-UHFFFAOYSA-N.
| Molecular formula | C14H16BNO2 |
|---|---|
| Molecular weight | 241.10 g/mol |
| IUPAC name | [2-[(2-methylanilino)methyl]phenyl]boronic acid |
| InChIKey | WLVOCMANYICPSJ-UHFFFAOYSA-N |
| SMILES | B(C1=CC=CC=C1CNC2=CC=CC=C2C)(O)O |
Computed by PubChem (NCBI)