cas: 1003043-73-9 — see every product listed under this CAS number, including other names
(2-(4-(tert-Butoxycarbonyl)piperazin-1-yl)pyridin-4-yl)boronic acid, 95%+, 95%+ (CAS 1003043-73-9) is a chemical reagent available from Chemat. Available pack sizes: 250mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1112K8-250mg |
| cas | 1003043-73-9 |
| size | 250mg |
| availability | 0.37g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 304.40 Pln |
| purity | 95%+ |
|---|---|
| delivery time | 3 weeks |
[2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-4-pyridinyl]boronic acid (CAS 1003043-73-9) is a chemical compound with the molecular formula C14H22BN3O4 and a molecular weight of 307.16 g/mol. IUPAC name: [2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-4-pyridinyl]boronic acid. InChIKey: NPPRXKFGYZIUSR-UHFFFAOYSA-N.
| Molecular formula | C14H22BN3O4 |
|---|---|
| Molecular weight | 307.16 g/mol |
| IUPAC name | [2-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-4-pyridinyl]boronic acid |
| InChIKey | NPPRXKFGYZIUSR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=NC=C1)N2CCN(CC2)C(=O)OC(C)(C)C)(O)O |
Computed by PubChem (NCBI)