CAS 1351272-41-7 appears in our catalog under these names: (2–(4–Vinylphenyl)ethene–1,1,2–triyl)tribenzene, (2-(4-Vinylphenyl)ethene-1,1,2-triyl)tribenzene, 98% mix TBC as stabilizer, 98% mix TBC as stabilizer, (2-(4-Vinylphenyl)ethene-1,1,2-triyl)tribenzene, 98%, (2-(4-Vinylphenyl)ethene-1,1,2-triyl)tribenzene, 98% mix TBC as stabilizer. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 1g, 250mg, 100mg, 5g, 25g, 10g.
1-ethenyl-4-(1,2,2-triphenylethenyl)benzene (CAS 1351272-41-7) is a chemical compound with the molecular formula C28H22 and a molecular weight of 358.5 g/mol. IUPAC name: 1-ethenyl-4-(1,2,2-triphenylethenyl)benzene. InChIKey: VDXVOUZXBSOCMM-UHFFFAOYSA-N.
| Molecular formula | C28H22 |
|---|---|
| Molecular weight | 358.5 g/mol |
| IUPAC name | 1-ethenyl-4-(1,2,2-triphenylethenyl)benzene |
| InChIKey | VDXVOUZXBSOCMM-UHFFFAOYSA-N |
| SMILES | C=CC1=CC=C(C=C1)C(=C(C2=CC=CC=C2)C3=CC=CC=C3)C4=CC=CC=C4 |
Computed by PubChem (NCBI)