CAS 1300750-50-8 appears in our catalog under these names: (2–(Difluoromethoxy)pyridin–3–yl)boronic acid, (2-(difluoromethoxy)pyridin-3-yl)boronic acid, 95%, 95%, (2-(Difluoromethoxy)pyridin-3-yl)boronic acid, 98%, (2-(Difluoromethoxy)pyridin-3-yl)boronic acid, 95%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g.
[2-(difluoromethoxy)-3-pyridinyl]boronic acid (CAS 1300750-50-8) is a chemical compound with the molecular formula C6H6BF2NO3 and a molecular weight of 188.93 g/mol. IUPAC name: [2-(difluoromethoxy)-3-pyridinyl]boronic acid. InChIKey: YTNMJXVIJXDALS-UHFFFAOYSA-N.
| Molecular formula | C6H6BF2NO3 |
|---|---|
| Molecular weight | 188.93 g/mol |
| IUPAC name | [2-(difluoromethoxy)-3-pyridinyl]boronic acid |
| InChIKey | YTNMJXVIJXDALS-UHFFFAOYSA-N |
| SMILES | B(C1=C(N=CC=C1)OC(F)F)(O)O |
Computed by PubChem (NCBI)