cas: 1339927-45-5 — see every product listed under this CAS number, including other names
(2-Amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)methanol, 97% (CAS 1339927-45-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A244998-1g |
| cas | 1339927-45-5 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 4809.28 Pln | |
| AmBeed | 5g | 14418.04 Pln | |
| AmBeed | 10g | 24697.33 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
[2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol (CAS 1339927-45-5) is a chemical compound with the molecular formula C13H20BNO3 and a molecular weight of 249.12 g/mol. IUPAC name: [2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol. InChIKey: WVJWLQOUWQOHRZ-UHFFFAOYSA-N.
| Molecular formula | C13H20BNO3 |
|---|---|
| Molecular weight | 249.12 g/mol |
| IUPAC name | [2-amino-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanol |
| InChIKey | WVJWLQOUWQOHRZ-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)N)CO |
Computed by PubChem (NCBI)