cas: 957066-07-8 — see every product listed under this CAS number, including other names
(2-Chloro-4-methoxy-5-(methoxycarbonyl)phenyl)boronic acid 95+% (CAS 957066-07-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A963751-100mg |
| cas | 957066-07-8 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 331.44 Pln | |
| Ambeed | 250mg | 381.50 Pln | |
| Ambeed | 1g | 1010.06 Pln |
| purity | 95+% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A963751 |
(2-chloro-4-methoxy-5-methoxycarbonylphenyl)boronic acid (CAS 957066-07-8) is a chemical compound with the molecular formula C9H10BClO5 and a molecular weight of 244.44 g/mol. IUPAC name: (2-chloro-4-methoxy-5-methoxycarbonylphenyl)boronic acid. InChIKey: ZIGSNYKPLGZLDR-UHFFFAOYSA-N.
| Molecular formula | C9H10BClO5 |
|---|---|
| Molecular weight | 244.44 g/mol |
| IUPAC name | (2-chloro-4-methoxy-5-methoxycarbonylphenyl)boronic acid |
| InChIKey | ZIGSNYKPLGZLDR-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=C(C=C1Cl)OC)C(=O)OC)(O)O |
Computed by PubChem (NCBI)