(2-Chloroquinolin-7-yl)methanol, 95%
cas: 1823116-42-2 — see every product listed under this CAS number, including other names
(2-Chloroquinolin-7-yl)methanol, 95% (CAS 1823116-42-2) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 50mg, 100mg. Offered by: Ambeed, BLDpharm, Chemat, Fluorochem.
| brand | Ambeed |
|---|---|
| catalog number | A323066-250mg |
| cas | 1823116-42-2 |
| size | 250mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 1271.50 Pln | |
| Ambeed | 1g | 2929.12 Pln | |
| BLDpharm | 50mg | 708.66 Pln | |
| BLDpharm | 100mg | 925.25 Pln | |
| BLDpharm | 250mg | 1363.99 Pln | |
| BLDpharm | 1g | 3152.25 Pln | |
| Chemat | 50mg | 678.80 Pln | |
| Chemat | 100mg | 890.00 Pln | |
| Chemat | 250mg | 1346.00 Pln | |
| Chemat | 1g | 3256.40 Pln | |
| Fluorochem | 1g | 6042.68 Pln | |
| Fluorochem | 50mg | 1257.91 Pln | |
| Fluorochem | 100mg | 1653.60 Pln | |
| Fluorochem | 250mg | 2497.05 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
(2-chloroquinolin-7-yl)methanol (CAS 1823116-42-2) is a chemical compound with the molecular formula C10H8ClNO and a molecular weight of 193.63 g/mol. IUPAC name: (2-chloroquinolin-7-yl)methanol. InChIKey: FGTCZEJPOPGONN-UHFFFAOYSA-N.
| Molecular formula | C10H8ClNO |
|---|---|
| Molecular weight | 193.63 g/mol |
| IUPAC name | (2-chloroquinolin-7-yl)methanol |
| InChIKey | FGTCZEJPOPGONN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=C1C=CC(=N2)Cl)CO |
Computed by PubChem (NCBI)