(2-Cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl)methanol, 97%
cas: 121660-11-5 — see every product listed under this CAS number, including other names
(2-Cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl)methanol, 97% (CAS 121660-11-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 100g, 500g. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A144722-100mg |
| cas | 121660-11-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 125.62 Pln | |
| Ambeed | 250mg | 131.19 Pln | |
| Ambeed | 1g | 147.88 Pln | |
| Ambeed | 5g | 175.69 Pln | |
| Ambeed | 10g | 275.81 Pln | |
| Ambeed | 25g | 442.69 Pln | |
| Ambeed | 100g | 887.69 Pln | |
| Chemat | 100mg | 74.00 Pln | |
| Chemat | 1g | 78.80 Pln | |
| Chemat | 5g | 136.40 Pln | |
| Chemat | 10g | 189.20 Pln | |
| Chemat | 25g | 347.60 Pln | |
| Chemat | 100g | 669.20 Pln | |
| Chemat | 500g | 1910.40 Pln | |
| BLDpharm | 100mg | 125.54 Pln | |
| BLDpharm | 250mg | 136.64 Pln | |
| BLDpharm | 1g | 153.30 Pln | |
| BLDpharm | 5g | 186.63 Pln | |
| BLDpharm | 10g | 292.14 Pln | |
| BLDpharm | 25g | 469.86 Pln | |
| BLDpharm | 100g | 947.47 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
[2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]methanol (CAS 121660-11-5) is a chemical compound with the molecular formula C19H16FNO and a molecular weight of 293.3 g/mol. IUPAC name: [2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]methanol. InChIKey: FIZDBNPUFMDGFZ-UHFFFAOYSA-N.
| Molecular formula | C19H16FNO |
|---|---|
| Molecular weight | 293.3 g/mol |
| IUPAC name | [2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]methanol |
| InChIKey | FIZDBNPUFMDGFZ-UHFFFAOYSA-N |
| SMILES | C1CC1C2=NC3=CC=CC=C3C(=C2CO)C4=CC=C(C=C4)F |
Computed by PubChem (NCBI)
Synonyms:
(2-Cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl)methanol, [2-cyclopropyl-4-(4-fluorophenyl)quinolin-3-yl]methanol, 2-Cyclopropyl-4-(4-fluorophenyl)-quinolyl-3-methanol, 2-Cyclopropyl-4-(4-fluorophenyl)-3-quinolinemethanol, 3-Quinolinemethanol, 2-cyclopropyl-4-(4-fluorophenyl)-, Pitavastatin Impurity 46, 2-Cyclopropyl-4-(4'-fluorophenyl) Quinolyl-3-methanol, (2-cyclopropyl-4-(4-fluorophenyl)quinoline-3-yl)methanol, FIZDBNPUFMDGFZ-UHFFFAOYSA-N, Pitavastatin Hydroxymethyl Impurity