cas: 627526-48-1 — see every product listed under this CAS number, including other names
(2-FLUORO-3-(TRIFLUOROMETHYL)PHENYL)BORONIC ACID PINACOL ESTER, 95% (CAS 627526-48-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F473978-250MG |
| cas | 627526-48-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 206.20 Pln | |
| Fluorochem | 1g | 440.49 Pln | |
| Fluorochem | 5g | 1330.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
2-[2-fluoro-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 627526-48-1) is a chemical compound with the molecular formula C13H15BF4O2 and a molecular weight of 290.06 g/mol. IUPAC name: 2-[2-fluoro-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: WQLUTKGUELUYQD-UHFFFAOYSA-N.
| Molecular formula | C13H15BF4O2 |
|---|---|
| Molecular weight | 290.06 g/mol |
| IUPAC name | 2-[2-fluoro-3-(trifluoromethyl)phenyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | WQLUTKGUELUYQD-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=C(C(=CC=C2)C(F)(F)F)F |
Computed by PubChem (NCBI)