CAS 2828439-68-3 is the registry number for (2-Methoxy-5-nitropyridin-3-yl)boronic acid, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(2-methoxy-5-nitro-3-pyridinyl)boronic acid (CAS 2828439-68-3) is a chemical compound with the molecular formula C6H7BN2O5 and a molecular weight of 197.94 g/mol. IUPAC name: (2-methoxy-5-nitro-3-pyridinyl)boronic acid. InChIKey: OARIUJIDRPCQMA-UHFFFAOYSA-N.
| Molecular formula | C6H7BN2O5 |
|---|---|
| Molecular weight | 197.94 g/mol |
| IUPAC name | (2-methoxy-5-nitro-3-pyridinyl)boronic acid |
| InChIKey | OARIUJIDRPCQMA-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CN=C1OC)[N+](=O)[O-])(O)O |
Computed by PubChem (NCBI)