(2-Oxo-2-phenylethyl)triphenylphosphonium bromide, 98%, 98%
cas: 6048-29-9 — see every product listed under this CAS number, including other names
(2-Oxo-2-phenylethyl)triphenylphosphonium bromide, 98%, 98% (CAS 6048-29-9) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 10g, 15g, 50g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114TNT-5g |
| cas | 6048-29-9 |
| size | 5g |
| availability | 1000g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 5g | 107.60 Pln | |
| Chemat | 25g | 213.20 Pln | |
| Chemat | 100g | 462.80 Pln | |
| Chemat | 500g | 2131.20 Pln | |
| Chemat | 10g | 150.80 Pln | |
| Chemat | 15g | 194.00 Pln | |
| Chemat | 50g | 347.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Phenacyl(triphenyl)phosphanium bromide (CAS 6048-29-9) is a chemical compound with the molecular formula C26H22BrOP and a molecular weight of 461.3 g/mol. IUPAC name: phenacyl(triphenyl)phosphanium bromide. InChIKey: AEHDSYHVTDJGDN-UHFFFAOYSA-M.
| Molecular formula | C26H22BrOP |
|---|---|
| Molecular weight | 461.3 g/mol |
| IUPAC name | phenacyl(triphenyl)phosphanium bromide |
| InChIKey | AEHDSYHVTDJGDN-UHFFFAOYSA-M |
| SMILES | C1=CC=C(C=C1)C(=O)C[P+](C2=CC=CC=C2)(C3=CC=CC=C3)C4=CC=CC=C4.[Br-] |
Computed by PubChem (NCBI)
Synonyms:
Phenacyltriphenylphosphonium bromide, (2-Oxo-2-phenylethyl)triphenylphosphonium bromide, phenacyl(triphenyl)phosphanium;bromide, Phosphonium, (2-oxo-2-phenylethyl)triphenyl-, bromide, Phosphonium, phenacyltriphenyl-, bromide, Phenacyltriphenylphosphoniumbromide, C26H22BrOP, Benzoylme, Benzoylmethyltriphenylphosphonium bromide, phenacyl(triphenyl)phosphonium;bromide