cas: 62085-74-9 — see every product listed under this CAS number, including other names
(2E,6E)-2,6-Bis(4-fluorobenzylidene)cyclohexanone, 97%, 97% (CAS 62085-74-9) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114G2O-100mg |
| cas | 62085-74-9 |
| size | 100mg |
| availability | 4g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 83.60 Pln | |
| Chemat | 250mg | 98.00 Pln | |
| Chemat | 1g | 136.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
(2E,6E)-2,6-bis[(4-fluorophenyl)methylidene]cyclohexan-1-one (CAS 62085-74-9) is a chemical compound with the molecular formula C20H16F2O and a molecular weight of 310.3 g/mol. IUPAC name: (2E,6E)-2,6-bis[(4-fluorophenyl)methylidene]cyclohexan-1-one. InChIKey: STPNBQOTKFPYEG-UNZYHPAISA-N.
| Molecular formula | C20H16F2O |
|---|---|
| Molecular weight | 310.3 g/mol |
| IUPAC name | (2E,6E)-2,6-bis[(4-fluorophenyl)methylidene]cyclohexan-1-one |
| InChIKey | STPNBQOTKFPYEG-UNZYHPAISA-N |
| SMILES | C1C/C(=C\C2=CC=C(C=C2)F)/C(=O)/C(=C/C3=CC=C(C=C3)F)/C1 |
Computed by PubChem (NCBI)