cas: 106-28-5 — see every product listed under this CAS number, including other names
(2E,6E)-3,7,11-Trimethyldodeca-2,6,10-trien-1-ol, 98%, 98% (CAS 106-28-5) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g, 250g, 500g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1146PJ-1g |
| cas | 106-28-5 |
| size | 1g |
| availability | 10000g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 74.00 Pln | |
| Chemat | 5g | 98.00 Pln | |
| Chemat | 10g | 126.80 Pln | |
| Chemat | 25g | 208.40 Pln | |
| Chemat | 50g | 342.80 Pln | |
| Chemat | 100g | 582.80 Pln | |
| Chemat | 250g | 1370.00 Pln | |
| Chemat | 500g | 2683.20 Pln | |
| Chemat | 5kg | 17448.00 Pln | |
| Chemat | 10kg | price on request |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Farnesol is a farnesane sesquiterpenoid that is dodeca-2,6,10-triene substituted by methyl groups at positions 3, 7 and 11 and a hydroxy group at position 1. It has a role as an antimicrobial agent, a plant metabolite and a fungal metabolite. It is a primary alcohol, a polyprenol and a farnesane sesquiterpenoid.
Source: ChEBI
| Molecular formula | C15H26O |
|---|---|
| Molecular weight | 222.37 g/mol |
| IUPAC name | (2E,6E)-3,7,11-trimethyldodeca-2,6,10-trien-1-ol |
| InChIKey | CRDAMVZIKSXKFV-YFVJMOTDSA-N |
| SMILES | CC(=CCC/C(=C/CC/C(=C/CO)/C)/C)C |
Computed by PubChem (NCBI)