cas: 77826-55-2 — see every product listed under this CAS number, including other names
(2R,2′R)-Dimethyl 3,3′-disulfanediylbis(2-((tert-butoxycarbonyl)amino)propanoate), 98%, 98% (CAS 77826-55-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11G5RG-100mg |
| cas | 77826-55-2 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 146.00 Pln | |
| Chemat | 250mg | 198.80 Pln | |
| Chemat | 1g | 438.80 Pln | |
| Chemat | 5g | 1058.00 Pln | |
| Chemat | 10g | 1797.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Methyl (2R)-3-[[(2R)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]disulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate (CAS 77826-55-2) is a chemical compound with the molecular formula C18H32N2O8S2 and a molecular weight of 468.6 g/mol. IUPAC name: methyl (2R)-3-[[(2R)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]disulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate. InChIKey: YYJNNBRJCNKRNJ-RYUDHWBXSA-N.
| Molecular formula | C18H32N2O8S2 |
|---|---|
| Molecular weight | 468.6 g/mol |
| IUPAC name | methyl (2R)-3-[[(2R)-3-methoxy-2-[(2-methylpropan-2-yl)oxycarbonylamino]-3-oxopropyl]disulfanyl]-2-[(2-methylpropan-2-yl)oxycarbonylamino]propanoate |
| InChIKey | YYJNNBRJCNKRNJ-RYUDHWBXSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@@H](CSSC[C@@H](C(=O)OC)NC(=O)OC(C)(C)C)C(=O)OC |
Computed by PubChem (NCBI)