cas: 2611-61-2 — see every product listed under this CAS number, including other names
(2R,3R)-2-(2,2-Dichloroacetamido)-3-hydroxy-3-(4-(methylsulfonyl)phenyl)propyl glycinate hydrochloride, 98%, 98% (CAS 2611-61-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11I5Z2-1g |
| cas | 2611-61-2 |
| size | 1g |
| availability | 75g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 405.20 Pln | |
| Chemat | 25g | 1091.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
[(2R,3R)-2-[(2,2-dichloroacetyl)amino]-3-hydroxy-3-(4-methylsulfonylphenyl)propyl] 2-aminoacetate;hydrochloride (CAS 2611-61-2) is a chemical compound with the molecular formula C14H19Cl3N2O6S and a molecular weight of 449.7 g/mol. IUPAC name: [(2R,3R)-2-[(2,2-dichloroacetyl)amino]-3-hydroxy-3-(4-methylsulfonylphenyl)propyl] 2-aminoacetate;hydrochloride. InChIKey: DKXJDBJNAXSJDH-MHDYBILJSA-N.
| Molecular formula | C14H19Cl3N2O6S |
|---|---|
| Molecular weight | 449.7 g/mol |
| IUPAC name | [(2R,3R)-2-[(2,2-dichloroacetyl)amino]-3-hydroxy-3-(4-methylsulfonylphenyl)propyl] 2-aminoacetate;hydrochloride |
| InChIKey | DKXJDBJNAXSJDH-MHDYBILJSA-N |
| SMILES | CS(=O)(=O)C1=CC=C(C=C1)[C@H]([C@@H](COC(=O)CN)NC(=O)C(Cl)Cl)O.Cl |
Computed by PubChem (NCBI)