(2R,3R)-Methyl 3-amino-2-methylbutanoate hydrochloride, 97%
cas: 2901043-62-5 — see every product listed under this CAS number, including other names
(2R,3R)-Methyl 3-amino-2-methylbutanoate hydrochloride, 97% (CAS 2901043-62-5) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 50mg. Offered by: Ambeed, Chemat, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A564189-100mg |
| cas | 2901043-62-5 |
| size | 100mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 1327.12 Pln | |
| Ambeed | 250mg | 2211.56 Pln | |
| Ambeed | 1g | 5849.44 Pln | |
| Chemat | 50mg | 606.80 Pln | |
| Chemat | 100mg | 1067.60 Pln | |
| Chemat | 250mg | 1970.00 Pln | |
| Chemat | 1g | 5397.20 Pln | |
| BLDpharm | 50mg | 803.08 Pln | |
| BLDpharm | 100mg | 1308.45 Pln | |
| BLDpharm | 250mg | 2169.26 Pln | |
| BLDpharm | 1g | 5734.67 Pln |
properties
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
Methyl (2R,3R)-3-amino-2-methylbutanoate;hydrochloride (CAS 2901043-62-5) is a chemical compound with the molecular formula C6H14ClNO2 and a molecular weight of 167.63 g/mol. IUPAC name: methyl (2R,3R)-3-amino-2-methylbutanoate;hydrochloride. InChIKey: ITONPVVRBAKUBZ-TYSVMGFPSA-N.
| Molecular formula | C6H14ClNO2 |
|---|---|
| Molecular weight | 167.63 g/mol |
| IUPAC name | methyl (2R,3R)-3-amino-2-methylbutanoate;hydrochloride |
| InChIKey | ITONPVVRBAKUBZ-TYSVMGFPSA-N |
| SMILES | C[C@H]([C@@H](C)N)C(=O)OC.Cl |
Computed by PubChem (NCBI)
Synonyms:
(2R,3R)-Methyl 3-amino-2-methylbutanoate hydrochloride, Methyl (R)-D-valinate hydrochloride, (2R,3R)-Methyl3-amino-2-methylbutanoatehydrochloride, (R,R)-Methyl 3-amino-2-methylbutyrate hydrochloride, methyl (2R,3R)-3-amino-2-methylbutanoate;hydrochloride, methyl (2R,3R)-3-amino-2-methyl-butanoate;hydrochloride, rel-(2R,3R)-Methyl 3-amino-2-methylbutanoate hydrochloride