cas: 1109-28-0 — see every product listed under this CAS number, including other names
(2R,3R,4R,5R)-4-(((2R,3R,4R,5S,6R)-3,4-Dihydroxy-6-(hydroxymethyl)-5-(((2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)tetrahydro-2H-pyran-2-yl)oxy)-2,3,5,6-tetrahydroxyhexanal, 98%, 98% (CAS 1109-28-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 250g, 500g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114002-100mg |
| cas | 1109-28-0 |
| size | 100mg |
| availability | 500g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 78.80 Pln | |
| Chemat | 250mg | 93.20 Pln | |
| Chemat | 1g | 160.40 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Chemat | 10g | 808.40 Pln | |
| Chemat | 250g | 13346.00 Pln | |
| Chemat | 500g | 23755.20 Pln | |
| Chemat | 25g | 1715.60 Pln | |
| Chemat | 50g | 3093.20 Pln | |
| Chemat | 100g | 5435.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Maltotriose is a maltotriose trisaccharide in which the glucose residue at the reducing end is in the aldehydo open-chain form.
Source: ChEBI
| Molecular formula | C18H32O16 |
|---|---|
| Molecular weight | 504.4 g/mol |
| IUPAC name | (2R,3R,4R,5R)-4-[(2R,3R,4R,5S,6R)-3,4-dihydroxy-6-(hydroxymethyl)-5-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyoxan-2-yl]oxy-2,3,5,6-tetrahydroxyhexanal |
| InChIKey | RXVWSYJTUUKTEA-CGQAXDJHSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@H](O1)O[C@@H]2[C@H](O[C@@H]([C@@H]([C@H]2O)O)O[C@H]([C@@H](CO)O)[C@@H]([C@H](C=O)O)O)CO)O)O)O)O |
Computed by PubChem (NCBI)