(2R,3R,4R,5S)-2-Hydroxymethyl-piperidine-3,4,5-triol, 98%, 98%
cas: 19130-96-2 — see every product listed under this CAS number, including other names
(2R,3R,4R,5S)-2-Hydroxymethyl-piperidine-3,4,5-triol, 98%, 98% (CAS 19130-96-2) is a chemical reagent available from Chemat. Available pack sizes: 25mg, 100mg, 250mg, 500mg, 1g, 5g, 10g, 2mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch1140EZ-25mg |
| cas | 19130-96-2 |
| size | 25mg |
| availability | 20g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 25mg | 117.20 Pln | |
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 500mg | 237.20 Pln | |
| Chemat | 1g | 342.80 Pln | |
| Chemat | 5g | 1149.20 Pln | |
| Chemat | 10g | 2037.20 Pln | |
| Chemat | 2mg | 78.80 Pln | |
| Chemat | 5mg | 83.60 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
Duvoglustat is an optically active form of 2-(hydroxymethyl)piperidine-3,4,5-triol having 2R,3R,4R,5S-configuration. It has a role as a hypoglycemic agent, a hepatoprotective agent, an anti-HIV agent, an EC 3.2.1.20 (alpha-glucosidase) inhibitor, an anti-obesity agent, a plant metabolite and a bacterial metabolite. It is a piperidine alkaloid and a 2-(hydroxymethyl)piperidine-3,4,5-triol.
Source: ChEBI
| Molecular formula | C6H13NO4 |
|---|---|
| Molecular weight | 163.17 g/mol |
| IUPAC name | (2R,3R,4R,5S)-2-(hydroxymethyl)piperidine-3,4,5-triol |
| InChIKey | LXBIFEVIBLOUGU-JGWLITMVSA-N |
| SMILES | C1[C@@H]([C@H]([C@@H]([C@H](N1)CO)O)O)O |
Computed by PubChem (NCBI)