CAS 1079083-63-8 appears in our catalog under these names: Dapagliflozin Impurity 75, Empagliflozin Impurity 19, O-Desethyl Dapagliflozin tetraacetate), >95% (HPLC), Empagliflozin tetraacetate. Offered by: Chemat Brand, TRC, Biosynth. Available pack sizes: on request, 10mg, 250mg, 50mg, 2mg, 1mg, 5mg, 25mg.
[(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[(4-hydroxyphenyl)methyl]phenyl]oxan-2-yl]methyl acetate (CAS 1079083-63-8) is a chemical compound with the molecular formula C27H29ClO10 and a molecular weight of 549.0 g/mol. IUPAC name: [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[(4-hydroxyphenyl)methyl]phenyl]oxan-2-yl]methyl acetate. InChIKey: IPPDHWALLUPDNH-MMKSVXGCSA-N.
| Molecular formula | C27H29ClO10 |
|---|---|
| Molecular weight | 549.0 g/mol |
| IUPAC name | [(2R,3R,4R,5S,6S)-3,4,5-triacetyloxy-6-[4-chloro-3-[(4-hydroxyphenyl)methyl]phenyl]oxan-2-yl]methyl acetate |
| InChIKey | IPPDHWALLUPDNH-MMKSVXGCSA-N |
| SMILES | CC(=O)OC[C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)C2=CC(=C(C=C2)Cl)CC3=CC=C(C=C3)O)OC(=O)C)OC(=O)C)OC(=O)C |
Computed by PubChem (NCBI)