cas: 115350-24-8 — see every product listed under this CAS number, including other names
(2R,3R,4S,5R)-2-Amino-4-(((2S,3R,4R,5S,6R)-3-amino-4,5-dihydroxy-6-(hydroxymethyl)tetrahydro-2H-pyran-2-yl)oxy)-3,5,6-trihydroxyhexanal dihydrochloride, ≥90%, ≥90% (CAS 115350-24-8) is a chemical reagent available from Chemat. Available pack sizes: 5mg, 25mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch12WSTP-5mg |
| cas | 115350-24-8 |
| size | 5mg |
| availability | 0.025g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 5mg | 107.60 Pln | |
| Chemat | 25mg | 184.40 Pln |
| purity | ≥90% |
|---|---|
| delivery time | 3 weeks |
(2R,3S,4R,5R,6S)-5-amino-6-[(2R,3S,4R,5R)-5-amino-4,6-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-2-(hydroxymethyl)oxane-3,4-diol;hydrochloride (CAS 115350-24-8) is a chemical compound with the molecular formula C12H25ClN2O9 and a molecular weight of 376.79 g/mol. IUPAC name: (2R,3S,4R,5R,6S)-5-amino-6-[(2R,3S,4R,5R)-5-amino-4,6-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-2-(hydroxymethyl)oxane-3,4-diol;hydrochloride. InChIKey: KIAPINRIHPDKSA-ZRQXRZBYSA-N.
| Molecular formula | C12H25ClN2O9 |
|---|---|
| Molecular weight | 376.79 g/mol |
| IUPAC name | (2R,3S,4R,5R,6S)-5-amino-6-[(2R,3S,4R,5R)-5-amino-4,6-dihydroxy-2-(hydroxymethyl)oxan-3-yl]oxy-2-(hydroxymethyl)oxane-3,4-diol;hydrochloride |
| InChIKey | KIAPINRIHPDKSA-ZRQXRZBYSA-N |
| SMILES | C([C@@H]1[C@H]([C@@H]([C@H]([C@@H](O1)O[C@@H]2[C@H](OC([C@@H]([C@H]2O)N)O)CO)N)O)O)O.Cl |
Computed by PubChem (NCBI)