cas: 41743-41-3 — see every product listed under this CAS number, including other names
(2R,3R,8S,14R,15R)-2,8-Bis(3,4-dihydroxyphenyl)-3,4-dihydro-2H,14H-8,14-methanobenzo[7,8][1,3]dioxocino[4,5-h]chromene-3,5,11,13,15-pentaol, 98% (CAS 41743-41-3) is a chemical reagent available from Chemat. Available pack sizes: 1mg, 5mg, 10mg, 25mg, 50mg, 100mg, 250mg. Offered by: BLDpharm, Chemat.
| brand | BLDpharm |
|---|---|
| catalog number | BD149108-1mg |
| cas | 41743-41-3 |
| size | 1mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| BLDpharm | 1mg | 486.52 Pln | |
| BLDpharm | 5mg | 1325.11 Pln | |
| BLDpharm | 10mg | 1952.67 Pln | |
| BLDpharm | 25mg | 2408.07 Pln | |
| BLDpharm | 50mg | 2896.78 Pln | |
| BLDpharm | 100mg | 3696.50 Pln | |
| BLDpharm | 250mg | 7328.56 Pln | |
| Chemat | 1mg | 261.20 Pln | |
| Chemat | 5mg | 558.80 Pln | |
| Chemat | 10mg | 803.60 Pln | |
| Chemat | 25mg | 1542.80 Pln | |
| Chemat | 50mg | 2286.80 Pln | |
| Chemat | 100mg | 4062.80 Pln | |
| Chemat | 250mg | 8066.00 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Proanthocyanidin A2 is a proanthocyanidin obtained by the condensation of ()-epicatechin units. It has a role as an antioxidant, a metabolite, an angiogenesis modulating agent and an anti-HIV agent. It is a proanthocyanidin and a hydroxyflavan. It is functionally related to a (-)-epicatechin.
Source: ChEBI
| Molecular formula | C30H24O12 |
|---|---|
| Molecular weight | 576.5 g/mol |
| IUPAC name | (1R,5R,6R,13S,21R)-5,13-bis(3,4-dihydroxyphenyl)-4,12,14-trioxapentacyclo[11.7.1.02,11.03,8.015,20]henicosa-2(11),3(8),9,15,17,19-hexaene-6,9,17,19,21-pentol |
| InChIKey | NSEWTSAADLNHNH-LSBOWGMISA-N |
| SMILES | C1[C@H]([C@H](OC2=C1C(=CC3=C2[C@@H]4[C@H]([C@](O3)(OC5=CC(=CC(=C45)O)O)C6=CC(=C(C=C6)O)O)O)O)C7=CC(=C(C=C7)O)O)O |
Computed by PubChem (NCBI)