cas: 138876-39-8 — see every product listed under this CAS number, including other names
(2R,3S)-1-(diphenylmethyl)-2-methylazetidin-3-ol, 98%, 98% (CAS 138876-39-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g, 50g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IL62-100mg |
| cas | 138876-39-8 |
| size | 100mg |
| availability | 1000g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 102.80 Pln | |
| Chemat | 250mg | 131.60 Pln | |
| Chemat | 1g | 198.80 Pln | |
| Chemat | 5g | 477.20 Pln | |
| Chemat | 10g | 750.80 Pln | |
| Chemat | 25g | 1442.00 Pln | |
| Chemat | 50g | 2474.00 Pln | |
| Chemat | 100g | 4197.20 Pln | |
| Chemat | 250g | 6549.20 Pln | |
| Chemat | 500g | 11049.60 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
(2R,3S)-1-benzhydryl-2-methylazetidin-3-ol (CAS 138876-39-8) is a chemical compound with the molecular formula C17H19NO and a molecular weight of 253.34 g/mol. IUPAC name: (2R,3S)-1-benzhydryl-2-methylazetidin-3-ol. InChIKey: RVJIUWJMJDLQIP-CJNGLKHVSA-N.
| Molecular formula | C17H19NO |
|---|---|
| Molecular weight | 253.34 g/mol |
| IUPAC name | (2R,3S)-1-benzhydryl-2-methylazetidin-3-ol |
| InChIKey | RVJIUWJMJDLQIP-CJNGLKHVSA-N |
| SMILES | C[C@@H]1[C@H](CN1C(C2=CC=CC=C2)C3=CC=CC=C3)O |
Computed by PubChem (NCBI)