(2R,3S)-2-((R)-1-(3,5-Bis(trifluoromethyl)phenyl)ethoxy)-3-(4-fluorophenyl)morpholine hydrochloride, 99%, 99%
cas: 171482-05-6 — see every product listed under this CAS number, including other names
(2R,3S)-2-((R)-1-(3,5-Bis(trifluoromethyl)phenyl)ethoxy)-3-(4-fluorophenyl)morpholine hydrochloride, 99%, 99% (CAS 171482-05-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 10g, 100g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11HZJN-100mg |
| cas | 171482-05-6 |
| size | 100mg |
| availability | 300g |
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 98.00 Pln | |
| Chemat | 250mg | 117.20 Pln | |
| Chemat | 1g | 146.00 Pln | |
| Chemat | 5g | 285.20 Pln | |
| Chemat | 25g | 870.80 Pln | |
| Chemat | 10g | 458.00 Pln | |
| Chemat | 100g | 2546.00 Pln |
properties
| purity | 99% |
|---|---|
| delivery time | 3 weeks |
(2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholine;hydrochloride (CAS 171482-05-6) is a chemical compound with the molecular formula C20H19ClF7NO2 and a molecular weight of 473.8 g/mol. IUPAC name: (2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholine;hydrochloride. InChIKey: DWCCMKXSGCKMJF-YNXGUESPSA-N.
| Molecular formula | C20H19ClF7NO2 |
|---|---|
| Molecular weight | 473.8 g/mol |
| IUPAC name | (2R,3S)-2-[(1R)-1-[3,5-bis(trifluoromethyl)phenyl]ethoxy]-3-(4-fluorophenyl)morpholine;hydrochloride |
| InChIKey | DWCCMKXSGCKMJF-YNXGUESPSA-N |
| SMILES | C[C@H](C1=CC(=CC(=C1)C(F)(F)F)C(F)(F)F)O[C@@H]2[C@@H](NCCO2)C3=CC=C(C=C3)F.Cl |
Computed by PubChem (NCBI)