cas: 1638587-36-6 — see every product listed under this CAS number, including other names
(2R,3S)-3-Methylhex-5-ene-2-sulfonamide, 97% (CAS 1638587-36-6) is a chemical reagent available from Chemat. Available pack sizes: 5g, 100mg, 250mg, 500mg, 1g, 10g. Offered by: AmBeed, Fluorochem.
| brand | AmBeed |
|---|---|
| catalog number | A1150809-5g |
| cas | 1638587-36-6 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 28395.01 Pln | |
| Fluorochem | 100mg | 1611.95 Pln | |
| Fluorochem | 250mg | 3153.07 Pln | |
| Fluorochem | 500mg | 4688.99 Pln | |
| Fluorochem | 1g | 6224.91 Pln | |
| Fluorochem | 5g | 18533.08 Pln | |
| Fluorochem | 10g | 30836.03 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2R,3S)-3-methylhex-5-ene-2-sulfonamide (CAS 1638587-36-6) is a chemical compound with the molecular formula C7H15NO2S and a molecular weight of 177.27 g/mol. IUPAC name: (2R,3S)-3-methylhex-5-ene-2-sulfonamide. InChIKey: OCSITWXGPHLSLB-NKWVEPMBSA-N.
| Molecular formula | C7H15NO2S |
|---|---|
| Molecular weight | 177.27 g/mol |
| IUPAC name | (2R,3S)-3-methylhex-5-ene-2-sulfonamide |
| InChIKey | OCSITWXGPHLSLB-NKWVEPMBSA-N |
| SMILES | C[C@@H](CC=C)[C@@H](C)S(=O)(=O)N |
Computed by PubChem (NCBI)