cas: 321744-25-6 — see every product listed under this CAS number, including other names
(2R,4R)-1-tert-Butyl 2-methyl 4-hydroxypiperidine-1,2-dicarboxylate, 98%, 98% (CAS 321744-25-6) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch114AT1-100mg |
| cas | 321744-25-6 |
| size | 100mg |
| availability | 15g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 587.60 Pln | |
| Chemat | 250mg | 947.60 Pln | |
| Chemat | 1g | 2306.00 Pln | |
| Chemat | 5g | 7149.20 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
1-O-tert-butyl 2-O-methyl (2R,4R)-4-hydroxypiperidine-1,2-dicarboxylate (CAS 321744-25-6) is a chemical compound with the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. IUPAC name: 1-O-tert-butyl 2-O-methyl (2R,4R)-4-hydroxypiperidine-1,2-dicarboxylate. InChIKey: RNMVWSAJMIKMDY-RKDXNWHRSA-N.
| Molecular formula | C12H21NO5 |
|---|---|
| Molecular weight | 259.30 g/mol |
| IUPAC name | 1-O-tert-butyl 2-O-methyl (2R,4R)-4-hydroxypiperidine-1,2-dicarboxylate |
| InChIKey | RNMVWSAJMIKMDY-RKDXNWHRSA-N |
| SMILES | CC(C)(C)OC(=O)N1CC[C@H](C[C@@H]1C(=O)OC)O |
Computed by PubChem (NCBI)