cas: 1820570-42-0 — see every product listed under this CAS number, including other names
(2R,4S)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)-4-((tert-butoxycarbonyl)amino)pyrrolidine-2-carboxylic acid, 97% (CAS 1820570-42-0) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 500mg, 1g, 2.5g, 5g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F749431-50MG |
| cas | 1820570-42-0 |
| size | 50mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 50mg | 372.80 Pln | |
| Fluorochem | 100mg | 476.93 Pln | |
| Fluorochem | 250mg | 810.15 Pln | |
| Fluorochem | 500mg | 1330.80 Pln | |
| Fluorochem | 1g | 1830.62 Pln | |
| Fluorochem | 2.5g | 4480.73 Pln | |
| Fluorochem | 5g | 7500.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
(2R,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-2-carboxylic acid (CAS 1820570-42-0) is a chemical compound with the molecular formula C25H28N2O6 and a molecular weight of 452.5 g/mol. IUPAC name: (2R,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-2-carboxylic acid. InChIKey: FJEXPICLVWOJSE-YCRPNKLZSA-N.
| Molecular formula | C25H28N2O6 |
|---|---|
| Molecular weight | 452.5 g/mol |
| IUPAC name | (2R,4S)-1-(9H-fluoren-9-ylmethoxycarbonyl)-4-[(2-methylpropan-2-yl)oxycarbonylamino]pyrrolidine-2-carboxylic acid |
| InChIKey | FJEXPICLVWOJSE-YCRPNKLZSA-N |
| SMILES | CC(C)(C)OC(=O)N[C@H]1C[C@@H](N(C1)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24)C(=O)O |
Computed by PubChem (NCBI)