cas: 790668-06-3 — see every product listed under this CAS number, including other names
(2R,4S)-tert-Butyl 4-hydroxy-2-methylpiperidine-1-carboxylate, 97%, 97% (CAS 790668-06-3) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 500mg, 1g, 5g, 25g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11GAI7-10g |
| cas | 790668-06-3 |
| size | 10g |
| availability | 26.51g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 10g | 2464.40 Pln | |
| Chemat | 100mg | 136.40 Pln | |
| Chemat | 250mg | 208.40 Pln | |
| Chemat | 500mg | 323.60 Pln | |
| Chemat | 1g | 472.40 Pln | |
| Chemat | 5g | 1413.20 Pln | |
| Chemat | 25g | 5690.00 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
Tert-butyl (2R,4S)-4-hydroxy-2-methylpiperidine-1-carboxylate (CAS 790668-06-3) is a chemical compound with the molecular formula C11H21NO3 and a molecular weight of 215.29 g/mol. IUPAC name: tert-butyl (2R,4S)-4-hydroxy-2-methylpiperidine-1-carboxylate. InChIKey: RCXJVQLRZJXWNM-BDAKNGLRSA-N.
| Molecular formula | C11H21NO3 |
|---|---|
| Molecular weight | 215.29 g/mol |
| IUPAC name | tert-butyl (2R,4S)-4-hydroxy-2-methylpiperidine-1-carboxylate |
| InChIKey | RCXJVQLRZJXWNM-BDAKNGLRSA-N |
| SMILES | C[C@@H]1C[C@H](CCN1C(=O)OC(C)(C)C)O |
Computed by PubChem (NCBI)