(2R,5S)-rel-Diethyl 2,5-dibromohexanedioate, 98%
cas: 54221-37-3 — see every product listed under this CAS number, including other names
(2R,5S)-rel-Diethyl 2,5-dibromohexanedioate, 98% (CAS 54221-37-3) is a chemical reagent available from Chemat. Available pack sizes: 5g, 25g, 100g, 500g, 1kg. Offered by: Ambeed, BLDpharm.
| brand | Ambeed |
|---|---|
| catalog number | A855502-5g |
| cas | 54221-37-3 |
| size | 5g |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 5g | 170.12 Pln | |
| Ambeed | 25g | 331.44 Pln | |
| Ambeed | 100g | 476.06 Pln | |
| Ambeed | 500g | 1738.75 Pln | |
| Ambeed | 1kg | 2906.88 Pln | |
| BLDpharm | 5g | 147.75 Pln | |
| BLDpharm | 25g | 325.47 Pln | |
| BLDpharm | 100g | 469.86 Pln | |
| BLDpharm | 500g | 1702.76 Pln | |
| BLDpharm | 1kg | 2846.80 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
Diethyl (2S,5R)-2,5-dibromohexanedioate (CAS 54221-37-3) is a chemical compound with the molecular formula C10H16Br2O4 and a molecular weight of 360.04 g/mol. IUPAC name: diethyl (2S,5R)-2,5-dibromohexanedioate. InChIKey: UBCNJHBDCUBIPB-OCAPTIKFSA-N.
| Molecular formula | C10H16Br2O4 |
|---|---|
| Molecular weight | 360.04 g/mol |
| IUPAC name | diethyl (2S,5R)-2,5-dibromohexanedioate |
| InChIKey | UBCNJHBDCUBIPB-OCAPTIKFSA-N |
| SMILES | CCOC(=O)[C@@H](CC[C@@H](C(=O)OCC)Br)Br |
Computed by PubChem (NCBI)
Synonyms:
Diethyl meso-2,5-dibromoadipate, (2R,5S)-rel-Diethyl 2,5-dibromohexanedioate, Diethyl (2R,5S)-2,5-dibromohexanedioate, diethyl (2S,5R)-2,5-dibromohexanedioate, (2R,5S)-rel-Diethyl2,5-dibromohexanedioate, (2S,5R)-Dibromo-hexanedioic acid diethyl ester, 2,5-dibromo-2,3-diethylhexanedioate, Diethyl meso-2,5-dibromoadipate, 98%, 2,5-bis(bromanyl)-2,3-diethyl-hexanedioate