cas: 32653-34-2 — see every product listed under this CAS number, including other names
(2S,3S)-2-Chloro-3-methylvaleric Acid, >95.0%(GC) (CAS 32653-34-2) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: TCI.
| brand | TCI |
|---|---|
| catalog number | C1372-1G |
| cas | 32653-34-2 |
| size | 1g |
| availability | 2 tygodnie|2 weeks |
| brand | size | price | |
|---|---|---|---|
| TCI | 1g | 285.53 Pln | |
| TCI | 5g | 870.68 Pln |
| delivery time | 2 weeks |
|---|---|
| category | chemicals |
| purity | >95.0%(GC) |
(2S,3S)-2-chloro-3-methylpentanoic acid (CAS 32653-34-2) is a chemical compound with the molecular formula C6H11ClO2 and a molecular weight of 150.60 g/mol. IUPAC name: (2S,3S)-2-chloro-3-methylpentanoic acid. InChIKey: QMYSXXQDOZTXAE-WHFBIAKZSA-N.
| Molecular formula | C6H11ClO2 |
|---|---|
| Molecular weight | 150.60 g/mol |
| IUPAC name | (2S,3S)-2-chloro-3-methylpentanoic acid |
| InChIKey | QMYSXXQDOZTXAE-WHFBIAKZSA-N |
| SMILES | CC[C@H](C)[C@@H](C(=O)O)Cl |
Computed by PubChem (NCBI)