cas: 166987-16-2 — see every product listed under this CAS number, including other names
(2S,3S)-3-Amino-1-chloro-4-phenylbutan-2-ol hydrochloride, 95%, 95% (CAS 166987-16-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IMPL-100mg |
| cas | 166987-16-2 |
| size | 100mg |
| availability | 20g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 131.60 Pln | |
| Chemat | 250mg | 165.20 Pln | |
| Chemat | 1g | 270.80 Pln | |
| Chemat | 5g | 611.60 Pln | |
| Chemat | 10g | 957.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S,3S)-3-amino-1-chloro-4-phenylbutan-2-ol;hydrochloride (CAS 166987-16-2) is a chemical compound with the molecular formula C10H15Cl2NO and a molecular weight of 236.13 g/mol. IUPAC name: (2S,3S)-3-amino-1-chloro-4-phenylbutan-2-ol;hydrochloride. InChIKey: UUFFFFLPZDDWLI-BAUSSPIASA-N.
| Molecular formula | C10H15Cl2NO |
|---|---|
| Molecular weight | 236.13 g/mol |
| IUPAC name | (2S,3S)-3-amino-1-chloro-4-phenylbutan-2-ol;hydrochloride |
| InChIKey | UUFFFFLPZDDWLI-BAUSSPIASA-N |
| SMILES | C1=CC=C(C=C1)C[C@@H]([C@@H](CCl)O)N.Cl |
Computed by PubChem (NCBI)