(2S,3S,4S,5R,6S)-2-(Methoxycarbonyl)-6-(2-nitro-4-((((4-nitrophenoxy)carbonyl)oxy)methyl)phenoxy)tetrahydro-2H-pyran-3,4,5-triyl triacetate, 95%
cas: 148580-01-2 — see every product listed under this CAS number, including other names
(2S,3S,4S,5R,6S)-2-(Methoxycarbonyl)-6-(2-nitro-4-((((4-nitrophenoxy)carbonyl)oxy)methyl)phenoxy)tetrahydro-2H-pyran-3,4,5-triyl triacetate, 95% (CAS 148580-01-2) is a chemical reagent available from Chemat. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg, 1g. Offered by: Ambeed, BLDpharm, Chemat.
| brand | Ambeed |
|---|---|
| catalog number | A1523578-10mg |
| cas | 148580-01-2 |
| size | 10mg |
Need more information?
Ask us about this product — we're happy to help.
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10mg | 381.50 Pln | |
| Ambeed | 25mg | 665.19 Pln | |
| Ambeed | 50mg | 1087.94 Pln | |
| Ambeed | 100mg | 1794.38 Pln | |
| Ambeed | 250mg | 3168.31 Pln | |
| Ambeed | 1g | 9999.06 Pln | |
| BLDpharm | 10mg | 408.77 Pln | |
| BLDpharm | 25mg | 714.22 Pln | |
| BLDpharm | 50mg | 1164.06 Pln | |
| BLDpharm | 100mg | 1930.46 Pln | |
| BLDpharm | 250mg | 3413.27 Pln | |
| BLDpharm | 1g | 10771.79 Pln | |
| Chemat | 10mg | 434.00 Pln | |
| Chemat | 25mg | 770.00 Pln | |
| Chemat | 50mg | 1269.20 Pln | |
| Chemat | 100mg | 2114.00 Pln | |
| Chemat | 250mg | 3750.80 Pln |
properties
| purity | 95% |
|---|---|
| delivery time | 2-3 weeks |
Methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-nitro-4-[(4-nitrophenoxy)carbonyloxymethyl]phenoxy]oxane-2-carboxylate (CAS 148580-01-2) is a chemical compound with the molecular formula C27H26N2O17 and a molecular weight of 650.5 g/mol. IUPAC name: methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-nitro-4-[(4-nitrophenoxy)carbonyloxymethyl]phenoxy]oxane-2-carboxylate. InChIKey: PFVWGUQXFZWIJM-IIDPJMFPSA-N.
| Molecular formula | C27H26N2O17 |
|---|---|
| Molecular weight | 650.5 g/mol |
| IUPAC name | methyl (2S,3S,4S,5R,6S)-3,4,5-triacetyloxy-6-[2-nitro-4-[(4-nitrophenoxy)carbonyloxymethyl]phenoxy]oxane-2-carboxylate |
| InChIKey | PFVWGUQXFZWIJM-IIDPJMFPSA-N |
| SMILES | CC(=O)O[C@H]1[C@@H]([C@H](O[C@H]([C@@H]1OC(=O)C)OC2=C(C=C(C=C2)COC(=O)OC3=CC=C(C=C3)[N+](=O)[O-])[N+](=O)[O-])C(=O)OC)OC(=O)C |
Computed by PubChem (NCBI)