cas: 1067189-36-9 — see every product listed under this CAS number, including other names
(2S,4R)-4-Mercaptopyrrolidine-2-carboxylic acid hydrochloride, 97% (CAS 1067189-36-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A712550-1g |
| cas | 1067189-36-9 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 11918.20 Pln | |
| AmBeed | 5g | 35529.97 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
(2S,4R)-4-sulfanylpyrrolidine-2-carboxylic acid;hydrochloride (CAS 1067189-36-9) is a chemical compound with the molecular formula C5H10ClNO2S and a molecular weight of 183.66 g/mol. IUPAC name: (2S,4R)-4-sulfanylpyrrolidine-2-carboxylic acid;hydrochloride. InChIKey: OBUGHYLMLADJFK-HJXLNUONSA-N.
| Molecular formula | C5H10ClNO2S |
|---|---|
| Molecular weight | 183.66 g/mol |
| IUPAC name | (2S,4R)-4-sulfanylpyrrolidine-2-carboxylic acid;hydrochloride |
| InChIKey | OBUGHYLMLADJFK-HJXLNUONSA-N |
| SMILES | C1[C@H](CN[C@@H]1C(=O)O)S.Cl |
Computed by PubChem (NCBI)