cas: 474417-79-3 — see every product listed under this CAS number, including other names
(2S,4S)-1-(tert-Butoxycarbonyl)-4-(difluoromethyl)pyrrolidine-2-carboxylic acid, 95%, 95% (CAS 474417-79-3) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11IMMF-50mg |
| cas | 474417-79-3 |
| size | 50mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 50mg | 501.20 Pln | |
| Chemat | 100mg | 813.20 Pln | |
| Chemat | 250mg | 1312.40 Pln | |
| Chemat | 1g | 3438.80 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
(2S,4S)-4-(difluoromethyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid (CAS 474417-79-3) is a chemical compound with the molecular formula C11H17F2NO4 and a molecular weight of 265.25 g/mol. IUPAC name: (2S,4S)-4-(difluoromethyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid. InChIKey: MYGMUZRVGABZMM-BQBZGAKWSA-N.
| Molecular formula | C11H17F2NO4 |
|---|---|
| Molecular weight | 265.25 g/mol |
| IUPAC name | (2S,4S)-4-(difluoromethyl)-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidine-2-carboxylic acid |
| InChIKey | MYGMUZRVGABZMM-BQBZGAKWSA-N |
| SMILES | CC(C)(C)OC(=O)N1C[C@H](C[C@H]1C(=O)O)C(F)F |
Computed by PubChem (NCBI)